About tert-butyl-[(2S)-3,3-dimethoxy-2-methylpropoxy]-dimethylsilane
tert-butyl-[(2S)-3,3-dimethoxy-2-methylpropoxy]-dimethylsilane (PubChem CID 10444722) has the molecular formula C12H28O3Si
and a molecular weight of 248.44 g/mol. Its IUPAC name is tert-butyl-[(2S)-3,3-dimethoxy-2-methylpropoxy]-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(2S)-3,3-dimethoxy-2-methylpropoxy]-dimethylsilane |
| PubChem CID | 10444722 |
| Molecular Formula | C12H28O3Si |
| Molecular Weight | 248.44 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | tert-butyl-[(2S)-3,3-dimethoxy-2-methylpropoxy]-dimethylsilane |
| SMILES | COC(OC)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H28O3Si/c1-10(11(13-5)14-6)9-15-16(7,8)12(2,3)4/h10-11H,9H2,1-8H3/t10-/m0/s1 |
| InChIKey | SXEJYOSLDIHNOK-JTQLQIEISA-N |
| XLogP | 3.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(2S)-3,3-dimethoxy-2-methylpropoxy]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(2S)-3,3-dimethoxy-2-methylpropoxy]-dimethylsilane?
The IUPAC name of tert-butyl-[(2S)-3,3-dimethoxy-2-methylpropoxy]-dimethylsilane (CID 10444722) is tert-butyl-[(2S)-3,3-dimethoxy-2-methylpropoxy]-dimethylsilane.
What is the SMILES notation for tert-butyl-[(2S)-3,3-dimethoxy-2-methylpropoxy]-dimethylsilane?
The canonical SMILES for tert-butyl-[(2S)-3,3-dimethoxy-2-methylpropoxy]-dimethylsilane is COC(OC)[C@@H](C)CO[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-[(2S)-3,3-dimethoxy-2-methylpropoxy]-dimethylsilane?
The InChIKey is SXEJYOSLDIHNOK-JTQLQIEISA-N. The full InChI is InChI=1S/C12H28O3Si/c1-10(11(13-5)14-6)9-15-16(7,8)12(2,3)4/h10-11H,9H2,1-8H3/t10-/m0/s1.
What are the key properties of tert-butyl-[(2S)-3,3-dimethoxy-2-methylpropoxy]-dimethylsilane?
tert-butyl-[(2S)-3,3-dimethoxy-2-methylpropoxy]-dimethylsilane has a molecular weight of 248.44 g/mol, XLogP of 3.26, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(2S)-3,3-dimethoxy-2-methylpropoxy]-dimethylsilane is sourced from PubChem (CID 10444722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).