About 2-phenylmethoxy-7,8-dihydro-6H-quinolin-5-one
2-phenylmethoxy-7,8-dihydro-6H-quinolin-5-one (PubChem CID 10444977) has the molecular formula C16H15NO2
and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-phenylmethoxy-7,8-dihydro-6H-quinolin-5-one.
Molecular Properties
| Compound Name | 2-phenylmethoxy-7,8-dihydro-6H-quinolin-5-one |
| PubChem CID | 10444977 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-phenylmethoxy-7,8-dihydro-6H-quinolin-5-one |
| SMILES | O=C1CCCc2nc(OCc3ccccc3)ccc21 |
| InChI | InChI=1S/C16H15NO2/c18-15-8-4-7-14-13(15)9-10-16(17-14)19-11-12-5-2-1-3-6-12/h1-3,5-6,9-10H,4,7-8,11H2 |
| InChIKey | VGMBEUFDLPGOMH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenylmethoxy-7,8-dihydro-6H-quinolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylmethoxy-7,8-dihydro-6H-quinolin-5-one?
The IUPAC name of 2-phenylmethoxy-7,8-dihydro-6H-quinolin-5-one (CID 10444977) is 2-phenylmethoxy-7,8-dihydro-6H-quinolin-5-one.
What is the SMILES notation for 2-phenylmethoxy-7,8-dihydro-6H-quinolin-5-one?
The canonical SMILES for 2-phenylmethoxy-7,8-dihydro-6H-quinolin-5-one is O=C1CCCc2nc(OCc3ccccc3)ccc21.
What is the InChIKey of 2-phenylmethoxy-7,8-dihydro-6H-quinolin-5-one?
The InChIKey is VGMBEUFDLPGOMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO2/c18-15-8-4-7-14-13(15)9-10-16(17-14)19-11-12-5-2-1-3-6-12/h1-3,5-6,9-10H,4,7-8,11H2.
What are the key properties of 2-phenylmethoxy-7,8-dihydro-6H-quinolin-5-one?
2-phenylmethoxy-7,8-dihydro-6H-quinolin-5-one has a molecular weight of 253.30 g/mol, XLogP of 3.18, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylmethoxy-7,8-dihydro-6H-quinolin-5-one is sourced from PubChem (CID 10444977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).