C14H19ClO2 — CID 10445055
(1S,10S,11S)-10-chloro-4,7-dioxatetracyclo[8.6.0.01,11.03,8]hexadec-3(8)-ene (PubChem CID 10445055) has the molecular formula C14H19ClO2 and a molecular weight of 254.76 g/mol. Its IUPAC name is (1S,10S,11S)-10-chloro-4,7-dioxatetracyclo[8.6.0.01,11.03,8]hexadec-3(8)-ene.
| Compound Name | (1S,10S,11S)-10-chloro-4,7-dioxatetracyclo[8.6.0.01,11.03,8]hexadec-3(8)-ene |
|---|---|
| PubChem CID | 10445055 |
| Molecular Formula | C14H19ClO2 |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | (1S,10S,11S)-10-chloro-4,7-dioxatetracyclo[8.6.0.01,11.03,8]hexadec-3(8)-ene |
| SMILES | Cl[C@]12CC3=C(C[C@]14CCCCC[C@@H]42)OCCO3 |
| InChI | InChI=1S/C14H19ClO2/c15-14-9-11-10(16-6-7-17-11)8-13(14)5-3-1-2-4-12(13)14/h12H,1-9H2/t12-,13-,14-/m0/s1 |
| InChIKey | QSFMVXRDFLAUEJ-IHRRRGAJSA-N |
| XLogP | 3.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|