C21H21BrO5 — CID 1044519
9-(3-bromo-5-ethoxy-4-hydroxyphenyl)-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione (PubChem CID 1044519) has the molecular formula C21H21BrO5 and a molecular weight of 433.30 g/mol. Its IUPAC name is 9-(3-bromo-5-ethoxy-4-hydroxyphenyl)-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione.
| Compound Name | 9-(3-bromo-5-ethoxy-4-hydroxyphenyl)-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 1044519 |
| Molecular Formula | C21H21BrO5 |
| Molecular Weight | 433.30 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 9-(3-bromo-5-ethoxy-4-hydroxyphenyl)-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
| SMILES | CCOc1cc(C2C3=C(CCCC3=O)OC3=C2C(=O)CCC3)cc(Br)c1O |
| InChI | InChI=1S/C21H21BrO5/c1-2-26-17-10-11(9-12(22)21(17)25)18-19-13(23)5-3-7-15(19)27-16-8-4-6-14(24)20(16)18/h9-10,18,25H,2-8H2,1H3 |
| InChIKey | DRNDYUYDKDCSTN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.30 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |