C15H9N3O2 — CID 10445452
2-amino-4-(furan-2-yl)indeno[1,2-d]pyrimidin-5-one (PubChem CID 10445452) has the molecular formula C15H9N3O2 and a molecular weight of 263.26 g/mol. Its IUPAC name is 2-amino-4-(furan-2-yl)indeno[1,2-d]pyrimidin-5-one.
| Compound Name | 2-amino-4-(furan-2-yl)indeno[1,2-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 10445452 |
| Molecular Formula | C15H9N3O2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 2-amino-4-(furan-2-yl)indeno[1,2-d]pyrimidin-5-one |
| SMILES | Nc1nc(-c2ccco2)c2c(n1)-c1ccccc1C2=O |
| InChI | InChI=1S/C15H9N3O2/c16-15-17-12-8-4-1-2-5-9(8)14(19)11(12)13(18-15)10-6-3-7-20-10/h1-7H,(H2,16,17,18) |
| InChIKey | KHOCZGQEVMEBSV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |