C18H20INO2 — CID 1044558
(1R)-6-ethoxy-1-(3-iodophenyl)-7-methoxy-1,2,3,4-tetrahydroisoquinoline (PubChem CID 1044558) has the molecular formula C18H20INO2 and a molecular weight of 409.27 g/mol. Its IUPAC name is (1R)-6-ethoxy-1-(3-iodophenyl)-7-methoxy-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (1R)-6-ethoxy-1-(3-iodophenyl)-7-methoxy-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 1044558 |
| Molecular Formula | C18H20INO2 |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | (1R)-6-ethoxy-1-(3-iodophenyl)-7-methoxy-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CCOc1cc2c(cc1OC)[C@@H](c1cccc(I)c1)NCC2 |
| InChI | InChI=1S/C18H20INO2/c1-3-22-17-10-12-7-8-20-18(15(12)11-16(17)21-2)13-5-4-6-14(19)9-13/h4-6,9-11,18,20H,3,7-8H2,1-2H3/t18-/m1/s1 |
| InChIKey | UPDPAIJDTMGEDP-GOSISDBHSA-N |
| XLogP | 3.93 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|