C17H19NO2 — CID 10445791
5-methyl-5-oxido-1-phenyl-1,3,4,6-tetrahydro-2,5-benzoxazocin-5-ium (PubChem CID 10445791) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 5-methyl-5-oxido-1-phenyl-1,3,4,6-tetrahydro-2,5-benzoxazocin-5-ium.
| Compound Name | 5-methyl-5-oxido-1-phenyl-1,3,4,6-tetrahydro-2,5-benzoxazocin-5-ium |
|---|---|
| PubChem CID | 10445791 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 5-methyl-5-oxido-1-phenyl-1,3,4,6-tetrahydro-2,5-benzoxazocin-5-ium |
| SMILES | C[N+]1([O-])CCOC(c2ccccc2)c2ccccc2C1 |
| InChI | InChI=1S/C17H19NO2/c1-18(19)11-12-20-17(14-7-3-2-4-8-14)16-10-6-5-9-15(16)13-18/h2-10,17H,11-13H2,1H3 |
| InChIKey | ADOSMCNCNFMWSW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|