C18H25NO — CID 10445902
(1R,2R)-N-(cyclopropylmethyl)-8-methoxy-1-prop-2-enyl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 10445902) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is (1R,2R)-N-(cyclopropylmethyl)-8-methoxy-1-prop-2-enyl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | (1R,2R)-N-(cyclopropylmethyl)-8-methoxy-1-prop-2-enyl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 10445902 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | (1R,2R)-N-(cyclopropylmethyl)-8-methoxy-1-prop-2-enyl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | C=CC[C@@H]1c2c(cccc2OC)CC[C@H]1NCC1CC1 |
| InChI | InChI=1S/C18H25NO/c1-3-5-15-16(19-12-13-8-9-13)11-10-14-6-4-7-17(20-2)18(14)15/h3-4,6-7,13,15-16,19H,1,5,8-12H2,2H3/t15-,16+/m0/s1 |
| InChIKey | ZDGCYKNKBKUIBF-JKSUJKDBSA-N |
| XLogP | 3.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|