About 2-(5-butyl-4,5-dihydro-1,3-thiazol-2-yl)acetate;tetramethylazanium
2-(5-butyl-4,5-dihydro-1,3-thiazol-2-yl)acetate;tetramethylazanium (PubChem CID 10446051) has the molecular formula C13H26N2O2S
and a molecular weight of 274.43 g/mol. Its IUPAC name is 2-(5-butyl-4,5-dihydro-1,3-thiazol-2-yl)acetate;tetramethylazanium.
Molecular Properties
| Compound Name | 2-(5-butyl-4,5-dihydro-1,3-thiazol-2-yl)acetate;tetramethylazanium |
| PubChem CID | 10446051 |
| Molecular Formula | C13H26N2O2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 2-(5-butyl-4,5-dihydro-1,3-thiazol-2-yl)acetate;tetramethylazanium |
| SMILES | CCCCC1CN=C(CC(=O)[O-])S1.C[N+](C)(C)C |
| InChI | InChI=1S/C9H15NO2S.C4H12N/c1-2-3-4-7-6-10-8(13-7)5-9(11)12;1-5(2,3)4/h7H,2-6H2,1H3,(H,11,12);1-4H3/q;+1/p-1 |
| InChIKey | IFZPZGAHHFXLKR-UHFFFAOYSA-M |
| XLogP | 1.15 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-butyl-4,5-dihydro-1,3-thiazol-2-yl)acetate;tetramethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-butyl-4,5-dihydro-1,3-thiazol-2-yl)acetate;tetramethylazanium?
The IUPAC name of 2-(5-butyl-4,5-dihydro-1,3-thiazol-2-yl)acetate;tetramethylazanium (CID 10446051) is 2-(5-butyl-4,5-dihydro-1,3-thiazol-2-yl)acetate;tetramethylazanium.
What is the SMILES notation for 2-(5-butyl-4,5-dihydro-1,3-thiazol-2-yl)acetate;tetramethylazanium?
The canonical SMILES for 2-(5-butyl-4,5-dihydro-1,3-thiazol-2-yl)acetate;tetramethylazanium is CCCCC1CN=C(CC(=O)[O-])S1.C[N+](C)(C)C.
What is the InChIKey of 2-(5-butyl-4,5-dihydro-1,3-thiazol-2-yl)acetate;tetramethylazanium?
The InChIKey is IFZPZGAHHFXLKR-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H15NO2S.C4H12N/c1-2-3-4-7-6-10-8(13-7)5-9(11)12;1-5(2,3)4/h7H,2-6H2,1H3,(H,11,12);1-4H3/q;+1/p-1.
What are the key properties of 2-(5-butyl-4,5-dihydro-1,3-thiazol-2-yl)acetate;tetramethylazanium?
2-(5-butyl-4,5-dihydro-1,3-thiazol-2-yl)acetate;tetramethylazanium has a molecular weight of 274.43 g/mol, XLogP of 1.15, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-butyl-4,5-dihydro-1,3-thiazol-2-yl)acetate;tetramethylazanium is sourced from PubChem (CID 10446051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).