About 4-(4,5-dichloro-6-oxopyridazin-1-yl)butyl acetate
4-(4,5-dichloro-6-oxopyridazin-1-yl)butyl acetate (PubChem CID 10446300) has the molecular formula C10H12Cl2N2O3
and a molecular weight of 279.12 g/mol. Its IUPAC name is 4-(4,5-dichloro-6-oxopyridazin-1-yl)butyl acetate.
Molecular Properties
| Compound Name | 4-(4,5-dichloro-6-oxopyridazin-1-yl)butyl acetate |
| PubChem CID | 10446300 |
| Molecular Formula | C10H12Cl2N2O3 |
| Molecular Weight | 279.12 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 4-(4,5-dichloro-6-oxopyridazin-1-yl)butyl acetate |
| SMILES | CC(=O)OCCCCn1ncc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C10H12Cl2N2O3/c1-7(15)17-5-3-2-4-14-10(16)9(12)8(11)6-13-14/h6H,2-5H2,1H3 |
| InChIKey | QYFNIFZRWSZNTN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.12 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,5-dichloro-6-oxopyridazin-1-yl)butyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-dichloro-6-oxopyridazin-1-yl)butyl acetate?
The IUPAC name of 4-(4,5-dichloro-6-oxopyridazin-1-yl)butyl acetate (CID 10446300) is 4-(4,5-dichloro-6-oxopyridazin-1-yl)butyl acetate.
What is the SMILES notation for 4-(4,5-dichloro-6-oxopyridazin-1-yl)butyl acetate?
The canonical SMILES for 4-(4,5-dichloro-6-oxopyridazin-1-yl)butyl acetate is CC(=O)OCCCCn1ncc(Cl)c(Cl)c1=O.
What is the InChIKey of 4-(4,5-dichloro-6-oxopyridazin-1-yl)butyl acetate?
The InChIKey is QYFNIFZRWSZNTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12Cl2N2O3/c1-7(15)17-5-3-2-4-14-10(16)9(12)8(11)6-13-14/h6H,2-5H2,1H3.
What are the key properties of 4-(4,5-dichloro-6-oxopyridazin-1-yl)butyl acetate?
4-(4,5-dichloro-6-oxopyridazin-1-yl)butyl acetate has a molecular weight of 279.12 g/mol, XLogP of 1.89, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-dichloro-6-oxopyridazin-1-yl)butyl acetate is sourced from PubChem (CID 10446300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).