About 8-nitro-10H-isoindolo[1,2-b]quinazolin-12-one
8-nitro-10H-isoindolo[1,2-b]quinazolin-12-one (PubChem CID 10446303) has the molecular formula C15H9N3O3
and a molecular weight of 279.25 g/mol. Its IUPAC name is 8-nitro-10H-isoindolo[1,2-b]quinazolin-12-one.
Molecular Properties
| Compound Name | 8-nitro-10H-isoindolo[1,2-b]quinazolin-12-one |
| PubChem CID | 10446303 |
| Molecular Formula | C15H9N3O3 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 8-nitro-10H-isoindolo[1,2-b]quinazolin-12-one |
| SMILES | O=C1c2ccccc2C2=Nc3ccc([N+](=O)[O-])cc3CN12 |
| InChI | InChI=1S/C15H9N3O3/c19-15-12-4-2-1-3-11(12)14-16-13-6-5-10(18(20)21)7-9(13)8-17(14)15/h1-7H,8H2 |
| InChIKey | GYMCJMPLGBTTQG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-nitro-10H-isoindolo[1,2-b]quinazolin-12-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-nitro-10H-isoindolo[1,2-b]quinazolin-12-one?
The IUPAC name of 8-nitro-10H-isoindolo[1,2-b]quinazolin-12-one (CID 10446303) is 8-nitro-10H-isoindolo[1,2-b]quinazolin-12-one.
What is the SMILES notation for 8-nitro-10H-isoindolo[1,2-b]quinazolin-12-one?
The canonical SMILES for 8-nitro-10H-isoindolo[1,2-b]quinazolin-12-one is O=C1c2ccccc2C2=Nc3ccc([N+](=O)[O-])cc3CN12.
What is the InChIKey of 8-nitro-10H-isoindolo[1,2-b]quinazolin-12-one?
The InChIKey is GYMCJMPLGBTTQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9N3O3/c19-15-12-4-2-1-3-11(12)14-16-13-6-5-10(18(20)21)7-9(13)8-17(14)15/h1-7H,8H2.
What are the key properties of 8-nitro-10H-isoindolo[1,2-b]quinazolin-12-one?
8-nitro-10H-isoindolo[1,2-b]quinazolin-12-one has a molecular weight of 279.25 g/mol, XLogP of 2.64, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-nitro-10H-isoindolo[1,2-b]quinazolin-12-one is sourced from PubChem (CID 10446303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).