About 1-(5,5-diphenyloxolan-3-yl)-N,N-dimethylmethanamine
1-(5,5-diphenyloxolan-3-yl)-N,N-dimethylmethanamine (PubChem CID 10446473) has the molecular formula C19H23NO
and a molecular weight of 281.40 g/mol. Its IUPAC name is 1-(5,5-diphenyloxolan-3-yl)-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-(5,5-diphenyloxolan-3-yl)-N,N-dimethylmethanamine |
| PubChem CID | 10446473 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 1-(5,5-diphenyloxolan-3-yl)-N,N-dimethylmethanamine |
| SMILES | CN(C)CC1COC(c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C19H23NO/c1-20(2)14-16-13-19(21-15-16,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,16H,13-15H2,1-2H3 |
| InChIKey | AMVCMSPVJGQNFF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(5,5-diphenyloxolan-3-yl)-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,5-diphenyloxolan-3-yl)-N,N-dimethylmethanamine?
The IUPAC name of 1-(5,5-diphenyloxolan-3-yl)-N,N-dimethylmethanamine (CID 10446473) is 1-(5,5-diphenyloxolan-3-yl)-N,N-dimethylmethanamine.
What is the SMILES notation for 1-(5,5-diphenyloxolan-3-yl)-N,N-dimethylmethanamine?
The canonical SMILES for 1-(5,5-diphenyloxolan-3-yl)-N,N-dimethylmethanamine is CN(C)CC1COC(c2ccccc2)(c2ccccc2)C1.
What is the InChIKey of 1-(5,5-diphenyloxolan-3-yl)-N,N-dimethylmethanamine?
The InChIKey is AMVCMSPVJGQNFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO/c1-20(2)14-16-13-19(21-15-16,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,16H,13-15H2,1-2H3.
What are the key properties of 1-(5,5-diphenyloxolan-3-yl)-N,N-dimethylmethanamine?
1-(5,5-diphenyloxolan-3-yl)-N,N-dimethylmethanamine has a molecular weight of 281.40 g/mol, XLogP of 3.53, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,5-diphenyloxolan-3-yl)-N,N-dimethylmethanamine is sourced from PubChem (CID 10446473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).