C14H13NO4S — CID 10446994
5-(4-aminophenyl)sulfanyl-2,3-dimethoxycyclohexa-2,5-diene-1,4-dione (PubChem CID 10446994) has the molecular formula C14H13NO4S and a molecular weight of 291.33 g/mol. Its IUPAC name is 5-(4-aminophenyl)sulfanyl-2,3-dimethoxycyclohexa-2,5-diene-1,4-dione.
| Compound Name | 5-(4-aminophenyl)sulfanyl-2,3-dimethoxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 10446994 |
| Molecular Formula | C14H13NO4S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 5-(4-aminophenyl)sulfanyl-2,3-dimethoxycyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)C(Sc2ccc(N)cc2)=CC1=O |
| InChI | InChI=1S/C14H13NO4S/c1-18-13-10(16)7-11(12(17)14(13)19-2)20-9-5-3-8(15)4-6-9/h3-7H,15H2,1-2H3 |
| InChIKey | GYZVVWCNWJDLDS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|