C16H25NO4 — CID 10447224
methyl (1S,2R,6S,7S,9S,10R)-7,10,13,13-tetramethyl-4,8-dioxa-3-azatetracyclo[8.2.1.02,9.03,7]tridecane-6-carboxylate (PubChem CID 10447224) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is methyl (1S,2R,6S,7S,9S,10R)-7,10,13,13-tetramethyl-4,8-dioxa-3-azatetracyclo[8.2.1.02,9.03,7]tridecane-6-carboxylate.
| Compound Name | methyl (1S,2R,6S,7S,9S,10R)-7,10,13,13-tetramethyl-4,8-dioxa-3-azatetracyclo[8.2.1.02,9.03,7]tridecane-6-carboxylate |
|---|---|
| PubChem CID | 10447224 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | methyl (1S,2R,6S,7S,9S,10R)-7,10,13,13-tetramethyl-4,8-dioxa-3-azatetracyclo[8.2.1.02,9.03,7]tridecane-6-carboxylate |
| SMILES | COC(=O)[C@H]1CON2[C@@H]3[C@H]4CC[C@@](C)([C@@H]3O[C@@]12C)C4(C)C |
| InChI | InChI=1S/C16H25NO4/c1-14(2)9-6-7-15(14,3)12-11(9)17-16(4,21-12)10(8-20-17)13(18)19-5/h9-12H,6-8H2,1-5H3/t9-,10-,11-,12-,15+,16+/m1/s1 |
| InChIKey | XDUMAQZJFHHMFV-GRUDOPTHSA-N |
| XLogP | 1.96 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |