About (4-ethenylphenyl) 3-acetamido-4-hydroxybenzoate
(4-ethenylphenyl) 3-acetamido-4-hydroxybenzoate (PubChem CID 10447329) has the molecular formula C17H15NO4
and a molecular weight of 297.31 g/mol. Its IUPAC name is (4-ethenylphenyl) 3-acetamido-4-hydroxybenzoate.
Molecular Properties
| Compound Name | (4-ethenylphenyl) 3-acetamido-4-hydroxybenzoate |
| PubChem CID | 10447329 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (4-ethenylphenyl) 3-acetamido-4-hydroxybenzoate |
| SMILES | C=Cc1ccc(OC(=O)c2ccc(O)c(NC(C)=O)c2)cc1 |
| InChI | InChI=1S/C17H15NO4/c1-3-12-4-7-14(8-5-12)22-17(21)13-6-9-16(20)15(10-13)18-11(2)19/h3-10,20H,1H2,2H3,(H,18,19) |
| InChIKey | GIZFCCIAJXWSKK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-ethenylphenyl) 3-acetamido-4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethenylphenyl) 3-acetamido-4-hydroxybenzoate?
The IUPAC name of (4-ethenylphenyl) 3-acetamido-4-hydroxybenzoate (CID 10447329) is (4-ethenylphenyl) 3-acetamido-4-hydroxybenzoate.
What is the SMILES notation for (4-ethenylphenyl) 3-acetamido-4-hydroxybenzoate?
The canonical SMILES for (4-ethenylphenyl) 3-acetamido-4-hydroxybenzoate is C=Cc1ccc(OC(=O)c2ccc(O)c(NC(C)=O)c2)cc1.
What is the InChIKey of (4-ethenylphenyl) 3-acetamido-4-hydroxybenzoate?
The InChIKey is GIZFCCIAJXWSKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO4/c1-3-12-4-7-14(8-5-12)22-17(21)13-6-9-16(20)15(10-13)18-11(2)19/h3-10,20H,1H2,2H3,(H,18,19).
What are the key properties of (4-ethenylphenyl) 3-acetamido-4-hydroxybenzoate?
(4-ethenylphenyl) 3-acetamido-4-hydroxybenzoate has a molecular weight of 297.31 g/mol, XLogP of 3.21, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethenylphenyl) 3-acetamido-4-hydroxybenzoate is sourced from PubChem (CID 10447329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).