About (E)-3-pyridin-4-yl-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-ol
(E)-3-pyridin-4-yl-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-ol (PubChem CID 10447581) has the molecular formula C17H19NO4
and a molecular weight of 301.34 g/mol. Its IUPAC name is (E)-3-pyridin-4-yl-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-ol.
Molecular Properties
| Compound Name | (E)-3-pyridin-4-yl-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-ol |
| PubChem CID | 10447581 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (E)-3-pyridin-4-yl-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-ol |
| SMILES | COc1cc(C(O)/C=C/c2ccncc2)cc(OC)c1OC |
| InChI | InChI=1S/C17H19NO4/c1-20-15-10-13(11-16(21-2)17(15)22-3)14(19)5-4-12-6-8-18-9-7-12/h4-11,14,19H,1-3H3/b5-4+ |
| InChIKey | SJGLLFHTIRAEEY-SNAWJCMRSA-N |
| XLogP | 2.85 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (E)-3-pyridin-4-yl-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-pyridin-4-yl-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-ol?
The IUPAC name of (E)-3-pyridin-4-yl-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-ol (CID 10447581) is (E)-3-pyridin-4-yl-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-ol.
What is the SMILES notation for (E)-3-pyridin-4-yl-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-ol?
The canonical SMILES for (E)-3-pyridin-4-yl-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-ol is COc1cc(C(O)/C=C/c2ccncc2)cc(OC)c1OC.
What is the InChIKey of (E)-3-pyridin-4-yl-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-ol?
The InChIKey is SJGLLFHTIRAEEY-SNAWJCMRSA-N. The full InChI is InChI=1S/C17H19NO4/c1-20-15-10-13(11-16(21-2)17(15)22-3)14(19)5-4-12-6-8-18-9-7-12/h4-11,14,19H,1-3H3/b5-4+.
What are the key properties of (E)-3-pyridin-4-yl-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-ol?
(E)-3-pyridin-4-yl-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-ol has a molecular weight of 301.34 g/mol, XLogP of 2.85, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-pyridin-4-yl-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-ol is sourced from PubChem (CID 10447581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).