C18H26O4 — CID 10447880
ethyl (1'S,4'aS)-1',4'a-dimethyl-2'-methylidenespiro[1,3-dioxolane-2,5'-3,4,6,7-tetrahydronaphthalene]-1'-carboxylate (PubChem CID 10447880) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is ethyl (1'S,4'aS)-1',4'a-dimethyl-2'-methylidenespiro[1,3-dioxolane-2,5'-3,4,6,7-tetrahydronaphthalene]-1'-carboxylate.
| Compound Name | ethyl (1'S,4'aS)-1',4'a-dimethyl-2'-methylidenespiro[1,3-dioxolane-2,5'-3,4,6,7-tetrahydronaphthalene]-1'-carboxylate |
|---|---|
| PubChem CID | 10447880 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | ethyl (1'S,4'aS)-1',4'a-dimethyl-2'-methylidenespiro[1,3-dioxolane-2,5'-3,4,6,7-tetrahydronaphthalene]-1'-carboxylate |
| SMILES | C=C1CC[C@@]2(C)C(=CCCC23OCCO3)[C@@]1(C)C(=O)OCC |
| InChI | InChI=1S/C18H26O4/c1-5-20-15(19)17(4)13(2)8-10-16(3)14(17)7-6-9-18(16)21-11-12-22-18/h7H,2,5-6,8-12H2,1,3-4H3/t16-,17-/m0/s1 |
| InChIKey | FCBQBEMNONERTJ-IRXDYDNUSA-N |
| XLogP | 3.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|