About [(3R)-2-oxononan-3-yl] 2-phenylsulfanylacetate
[(3R)-2-oxononan-3-yl] 2-phenylsulfanylacetate (PubChem CID 10448015) has the molecular formula C17H24O3S
and a molecular weight of 308.44 g/mol. Its IUPAC name is [(3R)-2-oxononan-3-yl] 2-phenylsulfanylacetate.
Molecular Properties
| Compound Name | [(3R)-2-oxononan-3-yl] 2-phenylsulfanylacetate |
| PubChem CID | 10448015 |
| Molecular Formula | C17H24O3S |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | [(3R)-2-oxononan-3-yl] 2-phenylsulfanylacetate |
| SMILES | CCCCCC[C@@H](OC(=O)CSc1ccccc1)C(C)=O |
| InChI | InChI=1S/C17H24O3S/c1-3-4-5-9-12-16(14(2)18)20-17(19)13-21-15-10-7-6-8-11-15/h6-8,10-11,16H,3-5,9,12-13H2,1-2H3/t16-/m1/s1 |
| InChIKey | LGYVUOFKIQUZNE-MRXNPFEDSA-N |
| XLogP | 4.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-2-oxononan-3-yl] 2-phenylsulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-2-oxononan-3-yl] 2-phenylsulfanylacetate?
The IUPAC name of [(3R)-2-oxononan-3-yl] 2-phenylsulfanylacetate (CID 10448015) is [(3R)-2-oxononan-3-yl] 2-phenylsulfanylacetate.
What is the SMILES notation for [(3R)-2-oxononan-3-yl] 2-phenylsulfanylacetate?
The canonical SMILES for [(3R)-2-oxononan-3-yl] 2-phenylsulfanylacetate is CCCCCC[C@@H](OC(=O)CSc1ccccc1)C(C)=O.
What is the InChIKey of [(3R)-2-oxononan-3-yl] 2-phenylsulfanylacetate?
The InChIKey is LGYVUOFKIQUZNE-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H24O3S/c1-3-4-5-9-12-16(14(2)18)20-17(19)13-21-15-10-7-6-8-11-15/h6-8,10-11,16H,3-5,9,12-13H2,1-2H3/t16-/m1/s1.
What are the key properties of [(3R)-2-oxononan-3-yl] 2-phenylsulfanylacetate?
[(3R)-2-oxononan-3-yl] 2-phenylsulfanylacetate has a molecular weight of 308.44 g/mol, XLogP of 4.25, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-2-oxononan-3-yl] 2-phenylsulfanylacetate is sourced from PubChem (CID 10448015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).