C11H16N2O6 — CID 10448026
(1S,2S,4S,5R,6R)-2-(3-aminopropanoylamino)-4-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid (PubChem CID 10448026) has the molecular formula C11H16N2O6 and a molecular weight of 272.26 g/mol. Its IUPAC name is (1S,2S,4S,5R,6R)-2-(3-aminopropanoylamino)-4-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid.
| Compound Name | (1S,2S,4S,5R,6R)-2-(3-aminopropanoylamino)-4-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 10448026 |
| Molecular Formula | C11H16N2O6 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (1S,2S,4S,5R,6R)-2-(3-aminopropanoylamino)-4-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| SMILES | NCCC(=O)N[C@@]1(C(=O)O)C[C@H](O)[C@H]2[C@H](C(=O)O)[C@H]21 |
| InChI | InChI=1S/C11H16N2O6/c12-2-1-5(15)13-11(10(18)19)3-4(14)6-7(8(6)11)9(16)17/h4,6-8,14H,1-3,12H2,(H,13,15)(H,16,17)(H,18,19)/t4-,6-,7-,8-,11-/m0/s1 |
| InChIKey | VUNWODCAVJFFDG-PBCZRHJCSA-N |
| XLogP | -2.01 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |