C16H22OSe — CID 10448039
(1S,4R,6R)-1,3,3-trimethyl-6-phenylselanyl-2-oxabicyclo[2.2.2]octane (PubChem CID 10448039) has the molecular formula C16H22OSe and a molecular weight of 309.31 g/mol. Its IUPAC name is (1S,4R,6R)-1,3,3-trimethyl-6-phenylselanyl-2-oxabicyclo[2.2.2]octane.
| Compound Name | (1S,4R,6R)-1,3,3-trimethyl-6-phenylselanyl-2-oxabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 10448039 |
| Molecular Formula | C16H22OSe |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | (1S,4R,6R)-1,3,3-trimethyl-6-phenylselanyl-2-oxabicyclo[2.2.2]octane |
| SMILES | CC1(C)O[C@@]2(C)CC[C@@H]1C[C@H]2[Se]c1ccccc1 |
| InChI | InChI=1S/C16H22OSe/c1-15(2)12-9-10-16(3,17-15)14(11-12)18-13-7-5-4-6-8-13/h4-8,12,14H,9-11H2,1-3H3/t12-,14-,16+/m1/s1 |
| InChIKey | AXZVWYNEAZFIEU-XPKDYRNWSA-N |
| XLogP | 3.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|