C18H18N2OS — CID 10448128
(3aS,5R)-3a,5-dimethyl-1-phenyl-4,5-dihydro-[1,2,4]oxadiazolo[5,4-d][1,5]benzothiazepine (PubChem CID 10448128) has the molecular formula C18H18N2OS and a molecular weight of 310.42 g/mol. Its IUPAC name is (3aS,5R)-3a,5-dimethyl-1-phenyl-4,5-dihydro-[1,2,4]oxadiazolo[5,4-d][1,5]benzothiazepine.
| Compound Name | (3aS,5R)-3a,5-dimethyl-1-phenyl-4,5-dihydro-[1,2,4]oxadiazolo[5,4-d][1,5]benzothiazepine |
|---|---|
| PubChem CID | 10448128 |
| Molecular Formula | C18H18N2OS |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (3aS,5R)-3a,5-dimethyl-1-phenyl-4,5-dihydro-[1,2,4]oxadiazolo[5,4-d][1,5]benzothiazepine |
| SMILES | C[C@@H]1C[C@]2(C)ON=C(c3ccccc3)N2c2ccccc2S1 |
| InChI | InChI=1S/C18H18N2OS/c1-13-12-18(2)20(15-10-6-7-11-16(15)22-13)17(19-21-18)14-8-4-3-5-9-14/h3-11,13H,12H2,1-2H3/t13-,18+/m1/s1 |
| InChIKey | AXDNOEIXABAWJD-ACJLOTCBSA-N |
| XLogP | 4.49 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |