C19H23NOS — CID 10448310
(1R,2R,5S)-5-phenylmethoxy-2-phenylsulfanylcyclohexan-1-amine (PubChem CID 10448310) has the molecular formula C19H23NOS and a molecular weight of 313.47 g/mol. Its IUPAC name is (1R,2R,5S)-5-phenylmethoxy-2-phenylsulfanylcyclohexan-1-amine.
| Compound Name | (1R,2R,5S)-5-phenylmethoxy-2-phenylsulfanylcyclohexan-1-amine |
|---|---|
| PubChem CID | 10448310 |
| Molecular Formula | C19H23NOS |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (1R,2R,5S)-5-phenylmethoxy-2-phenylsulfanylcyclohexan-1-amine |
| SMILES | N[C@@H]1C[C@@H](OCc2ccccc2)CC[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C19H23NOS/c20-18-13-16(21-14-15-7-3-1-4-8-15)11-12-19(18)22-17-9-5-2-6-10-17/h1-10,16,18-19H,11-14,20H2/t16-,18+,19+/m0/s1 |
| InChIKey | GZLMIDQXSWBNBS-QXAKKESOSA-N |
| XLogP | 4.24 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |