C12H20ClN3O3Si — CID 10448556
[(3aR,4R,5R,7aS)-5-azido-7-chloro-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl]oxy-trimethylsilane (PubChem CID 10448556) has the molecular formula C12H20ClN3O3Si and a molecular weight of 317.85 g/mol. Its IUPAC name is [(3aR,4R,5R,7aS)-5-azido-7-chloro-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl]oxy-trimethylsilane.
| Compound Name | [(3aR,4R,5R,7aS)-5-azido-7-chloro-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10448556 |
| Molecular Formula | C12H20ClN3O3Si |
| Molecular Weight | 317.85 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | [(3aR,4R,5R,7aS)-5-azido-7-chloro-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl]oxy-trimethylsilane |
| SMILES | CC1(C)O[C@H]2[C@H](O[Si](C)(C)C)[C@H](N=[N+]=[N-])C=C(Cl)[C@H]2O1 |
| InChI | InChI=1S/C12H20ClN3O3Si/c1-12(2)17-9-7(13)6-8(15-16-14)10(11(9)18-12)19-20(3,4)5/h6,8-11H,1-5H3/t8-,9-,10-,11-/m1/s1 |
| InChIKey | KFVIBGIDOWNGKH-GWOFURMSSA-N |
| XLogP | 3.54 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.85 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|