C19H23FO3 — CID 10448585
[(1R,3aS,7aR)-3-methylidene-1,2,3a,4,5,6,7,7a-octahydroinden-1-yl] (2R)-2-(4-fluorophenoxy)propanoate (PubChem CID 10448585) has the molecular formula C19H23FO3 and a molecular weight of 318.39 g/mol. Its IUPAC name is [(1R,3aS,7aR)-3-methylidene-1,2,3a,4,5,6,7,7a-octahydroinden-1-yl] (2R)-2-(4-fluorophenoxy)propanoate.
| Compound Name | [(1R,3aS,7aR)-3-methylidene-1,2,3a,4,5,6,7,7a-octahydroinden-1-yl] (2R)-2-(4-fluorophenoxy)propanoate |
|---|---|
| PubChem CID | 10448585 |
| Molecular Formula | C19H23FO3 |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | [(1R,3aS,7aR)-3-methylidene-1,2,3a,4,5,6,7,7a-octahydroinden-1-yl] (2R)-2-(4-fluorophenoxy)propanoate |
| SMILES | C=C1C[C@@H](OC(=O)[C@@H](C)Oc2ccc(F)cc2)[C@@H]2CCCC[C@H]12 |
| InChI | InChI=1S/C19H23FO3/c1-12-11-18(17-6-4-3-5-16(12)17)23-19(21)13(2)22-15-9-7-14(20)8-10-15/h7-10,13,16-18H,1,3-6,11H2,2H3/t13-,16-,17-,18-/m1/s1 |
| InChIKey | LCNPXNYBVXBLAP-BNEJOLLZSA-N |
| XLogP | 4.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|