C18H26O5 — CID 10448808
methyl (2'R,8'aS)-5,5,8'a-trimethyl-3'-oxospiro[1,3-dioxane-2,8'-2,5,6,7-tetrahydro-1H-naphthalene]-2'-carboxylate (PubChem CID 10448808) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is methyl (2'R,8'aS)-5,5,8'a-trimethyl-3'-oxospiro[1,3-dioxane-2,8'-2,5,6,7-tetrahydro-1H-naphthalene]-2'-carboxylate.
| Compound Name | methyl (2'R,8'aS)-5,5,8'a-trimethyl-3'-oxospiro[1,3-dioxane-2,8'-2,5,6,7-tetrahydro-1H-naphthalene]-2'-carboxylate |
|---|---|
| PubChem CID | 10448808 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | methyl (2'R,8'aS)-5,5,8'a-trimethyl-3'-oxospiro[1,3-dioxane-2,8'-2,5,6,7-tetrahydro-1H-naphthalene]-2'-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@]2(C)C(=CC1=O)CCCC21OCC(C)(C)CO1 |
| InChI | InChI=1S/C18H26O5/c1-16(2)10-22-18(23-11-16)7-5-6-12-8-14(19)13(15(20)21-4)9-17(12,18)3/h8,13H,5-7,9-11H2,1-4H3/t13-,17+/m1/s1 |
| InChIKey | HPNWRWYJRAAORB-DYVFJYSZSA-N |
| XLogP | 2.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|