C18H16N2O4 — CID 10448913
2-[(benzylamino)methyl]-3,7-dihydro-2H-[1,4]dioxino[2,3-e]indole-8,9-dione (PubChem CID 10448913) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is 2-[(benzylamino)methyl]-3,7-dihydro-2H-[1,4]dioxino[2,3-e]indole-8,9-dione.
| Compound Name | 2-[(benzylamino)methyl]-3,7-dihydro-2H-[1,4]dioxino[2,3-e]indole-8,9-dione |
|---|---|
| PubChem CID | 10448913 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 2-[(benzylamino)methyl]-3,7-dihydro-2H-[1,4]dioxino[2,3-e]indole-8,9-dione |
| SMILES | O=C1Nc2ccc3c(c2C1=O)OC(CNCc1ccccc1)CO3 |
| InChI | InChI=1S/C18H16N2O4/c21-16-15-13(20-18(16)22)6-7-14-17(15)24-12(10-23-14)9-19-8-11-4-2-1-3-5-11/h1-7,12,19H,8-10H2,(H,20,21,22) |
| InChIKey | ALQQHTNLZHNFSE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|