C21H27NO2 — CID 10449011
2-[(1S,4R)-1,8-diethyl-4-prop-2-enyl-2,3,4,9-tetrahydrocarbazol-1-yl]acetic acid (PubChem CID 10449011) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is 2-[(1S,4R)-1,8-diethyl-4-prop-2-enyl-2,3,4,9-tetrahydrocarbazol-1-yl]acetic acid.
| Compound Name | 2-[(1S,4R)-1,8-diethyl-4-prop-2-enyl-2,3,4,9-tetrahydrocarbazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 10449011 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 2-[(1S,4R)-1,8-diethyl-4-prop-2-enyl-2,3,4,9-tetrahydrocarbazol-1-yl]acetic acid |
| SMILES | C=CC[C@H]1CC[C@@](CC)(CC(=O)O)c2[nH]c3c(CC)cccc3c21 |
| InChI | InChI=1S/C21H27NO2/c1-4-8-15-11-12-21(6-3,13-17(23)24)20-18(15)16-10-7-9-14(5-2)19(16)22-20/h4,7,9-10,15,22H,1,5-6,8,11-13H2,2-3H3,(H,23,24)/t15-,21-/m0/s1 |
| InChIKey | UAEJNSQRUZHGCS-BTYIYWSLSA-N |
| XLogP | 5.31 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|