C20H30N2O2 — CID 10449331
(3R,5S)-3-ethyl-5-octyl-3-pyridin-4-ylpiperidine-2,6-dione (PubChem CID 10449331) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is (3R,5S)-3-ethyl-5-octyl-3-pyridin-4-ylpiperidine-2,6-dione.
| Compound Name | (3R,5S)-3-ethyl-5-octyl-3-pyridin-4-ylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 10449331 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | (3R,5S)-3-ethyl-5-octyl-3-pyridin-4-ylpiperidine-2,6-dione |
| SMILES | CCCCCCCC[C@H]1C[C@](CC)(c2ccncc2)C(=O)NC1=O |
| InChI | InChI=1S/C20H30N2O2/c1-3-5-6-7-8-9-10-16-15-20(4-2,19(24)22-18(16)23)17-11-13-21-14-12-17/h11-14,16H,3-10,15H2,1-2H3,(H,22,23,24)/t16-,20+/m0/s1 |
| InChIKey | FMESRHWFJJFVEB-OXJNMPFZSA-N |
| XLogP | 4.14 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|