C21H34OSi — CID 10449336
(5R,6R)-5-prop-1-ynyl-5-trimethylsilylpentadeca-1,7,8,14-tetraen-6-ol (PubChem CID 10449336) has the molecular formula C21H34OSi and a molecular weight of 330.59 g/mol. Its IUPAC name is (5R,6R)-5-prop-1-ynyl-5-trimethylsilylpentadeca-1,7,8,14-tetraen-6-ol.
| Compound Name | (5R,6R)-5-prop-1-ynyl-5-trimethylsilylpentadeca-1,7,8,14-tetraen-6-ol |
|---|---|
| PubChem CID | 10449336 |
| Molecular Formula | C21H34OSi |
| Molecular Weight | 330.59 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | (5R,6R)-5-prop-1-ynyl-5-trimethylsilylpentadeca-1,7,8,14-tetraen-6-ol |
| SMILES | C=CCCCCC=C=C[C@@H](O)[C@](C#CC)(CCC=C)[Si](C)(C)C |
| InChI | InChI=1S/C21H34OSi/c1-7-10-12-13-14-15-16-17-20(22)21(18-9-3,19-11-8-2)23(4,5)6/h7-8,15,17,20,22H,1-2,10-14,19H2,3-6H3/t16?,20-,21+/m1/s1 |
| InChIKey | UHJYFEZPQOIKPM-XHEPWMPHSA-N |
| XLogP | 5.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.59 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|