C17H18ClN3S — CID 10449405
6-chloro-N-(3-methylsulfanylpropyl)-5-phenyl-1H-indazol-3-amine (PubChem CID 10449405) has the molecular formula C17H18ClN3S and a molecular weight of 331.87 g/mol. Its IUPAC name is 6-chloro-N-(3-methylsulfanylpropyl)-5-phenyl-1H-indazol-3-amine.
| Compound Name | 6-chloro-N-(3-methylsulfanylpropyl)-5-phenyl-1H-indazol-3-amine |
|---|---|
| PubChem CID | 10449405 |
| Molecular Formula | C17H18ClN3S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 6-chloro-N-(3-methylsulfanylpropyl)-5-phenyl-1H-indazol-3-amine |
| SMILES | CSCCCNc1n[nH]c2cc(Cl)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C17H18ClN3S/c1-22-9-5-8-19-17-14-10-13(12-6-3-2-4-7-12)15(18)11-16(14)20-21-17/h2-4,6-7,10-11H,5,8-9H2,1H3,(H2,19,20,21) |
| InChIKey | QAXGGXLFXJUNCL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|