C16H32O5Si — CID 10449462
methyl 2-[(2R,3S,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-3,5-dimethyloxan-2-yl]acetate (PubChem CID 10449462) has the molecular formula C16H32O5Si and a molecular weight of 332.51 g/mol. Its IUPAC name is methyl 2-[(2R,3S,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-3,5-dimethyloxan-2-yl]acetate.
| Compound Name | methyl 2-[(2R,3S,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-3,5-dimethyloxan-2-yl]acetate |
|---|---|
| PubChem CID | 10449462 |
| Molecular Formula | C16H32O5Si |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | methyl 2-[(2R,3S,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-3,5-dimethyloxan-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1OC(O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C16H32O5Si/c1-10-12(9-13(17)19-6)20-15(18)11(2)14(10)21-22(7,8)16(3,4)5/h10-12,14-15,18H,9H2,1-8H3/t10-,11+,12+,14-,15?/m0/s1 |
| InChIKey | GHDXLDDGPFYKKB-FYMBCYDESA-N |
| XLogP | 2.93 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|