About 3-[(2,4-difluorophenyl)methyl]-2-methyl-6-methylsulfonyl-1H-indole
3-[(2,4-difluorophenyl)methyl]-2-methyl-6-methylsulfonyl-1H-indole (PubChem CID 10449604) has the molecular formula C17H15F2NO2S
and a molecular weight of 335.38 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methyl]-2-methyl-6-methylsulfonyl-1H-indole.
Molecular Properties
| Compound Name | 3-[(2,4-difluorophenyl)methyl]-2-methyl-6-methylsulfonyl-1H-indole |
| PubChem CID | 10449604 |
| Molecular Formula | C17H15F2NO2S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methyl]-2-methyl-6-methylsulfonyl-1H-indole |
| SMILES | Cc1[nH]c2cc(S(C)(=O)=O)ccc2c1Cc1ccc(F)cc1F |
| InChI | InChI=1S/C17H15F2NO2S/c1-10-15(7-11-3-4-12(18)8-16(11)19)14-6-5-13(23(2,21)22)9-17(14)20-10/h3-6,8-9,20H,7H2,1-2H3 |
| InChIKey | HEQWADUEXFRBSK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,4-difluorophenyl)methyl]-2-methyl-6-methylsulfonyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,4-difluorophenyl)methyl]-2-methyl-6-methylsulfonyl-1H-indole?
The IUPAC name of 3-[(2,4-difluorophenyl)methyl]-2-methyl-6-methylsulfonyl-1H-indole (CID 10449604) is 3-[(2,4-difluorophenyl)methyl]-2-methyl-6-methylsulfonyl-1H-indole.
What is the SMILES notation for 3-[(2,4-difluorophenyl)methyl]-2-methyl-6-methylsulfonyl-1H-indole?
The canonical SMILES for 3-[(2,4-difluorophenyl)methyl]-2-methyl-6-methylsulfonyl-1H-indole is Cc1[nH]c2cc(S(C)(=O)=O)ccc2c1Cc1ccc(F)cc1F.
What is the InChIKey of 3-[(2,4-difluorophenyl)methyl]-2-methyl-6-methylsulfonyl-1H-indole?
The InChIKey is HEQWADUEXFRBSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F2NO2S/c1-10-15(7-11-3-4-12(18)8-16(11)19)14-6-5-13(23(2,21)22)9-17(14)20-10/h3-6,8-9,20H,7H2,1-2H3.
What are the key properties of 3-[(2,4-difluorophenyl)methyl]-2-methyl-6-methylsulfonyl-1H-indole?
3-[(2,4-difluorophenyl)methyl]-2-methyl-6-methylsulfonyl-1H-indole has a molecular weight of 335.38 g/mol, XLogP of 3.75, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,4-difluorophenyl)methyl]-2-methyl-6-methylsulfonyl-1H-indole is sourced from PubChem (CID 10449604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).