C21H14N4O — CID 10449783
3,10-diphenyl-[1,2,4]triazino[4,3-a]benzimidazol-4-one (PubChem CID 10449783) has the molecular formula C21H14N4O and a molecular weight of 338.37 g/mol. Its IUPAC name is 3,10-diphenyl-[1,2,4]triazino[4,3-a]benzimidazol-4-one.
| Compound Name | 3,10-diphenyl-[1,2,4]triazino[4,3-a]benzimidazol-4-one |
|---|---|
| PubChem CID | 10449783 |
| Molecular Formula | C21H14N4O |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 3,10-diphenyl-[1,2,4]triazino[4,3-a]benzimidazol-4-one |
| SMILES | O=c1c(-c2ccccc2)nnc2n(-c3ccccc3)c3ccccc3n12 |
| InChI | InChI=1S/C21H14N4O/c26-20-19(15-9-3-1-4-10-15)22-23-21-24(16-11-5-2-6-12-16)17-13-7-8-14-18(17)25(20)21/h1-14H |
| InChIKey | BFVHCJSDSWWYEY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |