C16H17NNaO4P+2 — CID 10450026
sodium [(4-ethoxycarbonylanilino)-phenylmethyl]-hydroxy-oxophosphanium (PubChem CID 10450026) has the molecular formula C16H17NNaO4P+2 and a molecular weight of 341.28 g/mol. Its IUPAC name is sodium [(4-ethoxycarbonylanilino)-phenylmethyl]-hydroxy-oxophosphanium.
| Compound Name | sodium [(4-ethoxycarbonylanilino)-phenylmethyl]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 10450026 |
| Molecular Formula | C16H17NNaO4P+2 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | sodium [(4-ethoxycarbonylanilino)-phenylmethyl]-hydroxy-oxophosphanium |
| SMILES | CCOC(=O)c1ccc(NC(c2ccccc2)[P+](=O)O)cc1.[Na+] |
| InChI | InChI=1S/C16H16NO4P.Na/c1-2-21-16(18)13-8-10-14(11-9-13)17-15(22(19)20)12-6-4-3-5-7-12;/h3-11,15H,2H2,1H3,(H-,17,18,19,20);/q;+1/p+1 |
| InChIKey | LAXXIHGJFBMIKN-UHFFFAOYSA-O |
| XLogP | 0.71 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|