C17H26N2O2 — CID 104500779
2-amino-4-[cyclopentyl(3-methylbutyl)amino]benzoic acid (PubChem CID 104500779) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-amino-4-[cyclopentyl(3-methylbutyl)amino]benzoic acid.
| Compound Name | 2-amino-4-[cyclopentyl(3-methylbutyl)amino]benzoic acid |
|---|---|
| PubChem CID | 104500779 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 2-amino-4-[cyclopentyl(3-methylbutyl)amino]benzoic acid |
| SMILES | CC(C)CCN(c1ccc(C(=O)O)c(N)c1)C1CCCC1 |
| InChI | InChI=1S/C17H26N2O2/c1-12(2)9-10-19(13-5-3-4-6-13)14-7-8-15(17(20)21)16(18)11-14/h7-8,11-13H,3-6,9-10,18H2,1-2H3,(H,20,21) |
| InChIKey | OXMIFNZUDDXJJI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|