C16H23NO2 — CID 104501223
2-[2-(3-methylbutoxy)ethyl]-3,4-dihydroisoquinolin-1-one (PubChem CID 104501223) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 2-[2-(3-methylbutoxy)ethyl]-3,4-dihydroisoquinolin-1-one.
| Compound Name | 2-[2-(3-methylbutoxy)ethyl]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 104501223 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 2-[2-(3-methylbutoxy)ethyl]-3,4-dihydroisoquinolin-1-one |
| SMILES | CC(C)CCOCCN1CCc2ccccc2C1=O |
| InChI | InChI=1S/C16H23NO2/c1-13(2)8-11-19-12-10-17-9-7-14-5-3-4-6-15(14)16(17)18/h3-6,13H,7-12H2,1-2H3 |
| InChIKey | LDDDWORGGUWOHG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|