C21H28O4 — CID 10450195
(4bR,8aR)-1-hydroxy-8a-methoxy-4b,8,8-trimethyl-2-prop-1-en-2-yl-6,7,9,10-tetrahydro-5H-phenanthrene-3,4-dione (PubChem CID 10450195) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is (4bR,8aR)-1-hydroxy-8a-methoxy-4b,8,8-trimethyl-2-prop-1-en-2-yl-6,7,9,10-tetrahydro-5H-phenanthrene-3,4-dione.
| Compound Name | (4bR,8aR)-1-hydroxy-8a-methoxy-4b,8,8-trimethyl-2-prop-1-en-2-yl-6,7,9,10-tetrahydro-5H-phenanthrene-3,4-dione |
|---|---|
| PubChem CID | 10450195 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | (4bR,8aR)-1-hydroxy-8a-methoxy-4b,8,8-trimethyl-2-prop-1-en-2-yl-6,7,9,10-tetrahydro-5H-phenanthrene-3,4-dione |
| SMILES | C=C(C)C1=C(O)C2=C(C(=O)C1=O)[C@@]1(C)CCCC(C)(C)[C@]1(OC)CC2 |
| InChI | InChI=1S/C21H28O4/c1-12(2)14-16(22)13-8-11-21(25-6)19(3,4)9-7-10-20(21,5)15(13)18(24)17(14)23/h22H,1,7-11H2,2-6H3/t20-,21-/m1/s1 |
| InChIKey | AKIVFXSJXSNFJH-NHCUHLMSSA-N |
| XLogP | 4.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|