C21H28O4 — CID 10450199
(3R,3aR,4R,6aR)-3-benzyl-4-octyl-3,3a,4,6a-tetrahydrofuro[3,4-b]furan-2,6-dione (PubChem CID 10450199) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is (3R,3aR,4R,6aR)-3-benzyl-4-octyl-3,3a,4,6a-tetrahydrofuro[3,4-b]furan-2,6-dione.
| Compound Name | (3R,3aR,4R,6aR)-3-benzyl-4-octyl-3,3a,4,6a-tetrahydrofuro[3,4-b]furan-2,6-dione |
|---|---|
| PubChem CID | 10450199 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | (3R,3aR,4R,6aR)-3-benzyl-4-octyl-3,3a,4,6a-tetrahydrofuro[3,4-b]furan-2,6-dione |
| SMILES | CCCCCCCC[C@H]1OC(=O)[C@@H]2OC(=O)[C@H](Cc3ccccc3)[C@H]12 |
| InChI | InChI=1S/C21H28O4/c1-2-3-4-5-6-10-13-17-18-16(14-15-11-8-7-9-12-15)20(22)25-19(18)21(23)24-17/h7-9,11-12,16-19H,2-6,10,13-14H2,1H3/t16-,17-,18-,19-/m1/s1 |
| InChIKey | ZDEBQCRSXOJQKP-NCXUSEDFSA-N |
| XLogP | 4.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|