C20H31NO2Si — CID 10450283
methyl (4aS,5R,8aR)-5-[[dimethyl(phenyl)silyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate (PubChem CID 10450283) has the molecular formula C20H31NO2Si and a molecular weight of 345.56 g/mol. Its IUPAC name is methyl (4aS,5R,8aR)-5-[[dimethyl(phenyl)silyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate.
| Compound Name | methyl (4aS,5R,8aR)-5-[[dimethyl(phenyl)silyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 10450283 |
| Molecular Formula | C20H31NO2Si |
| Molecular Weight | 345.56 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | methyl (4aS,5R,8aR)-5-[[dimethyl(phenyl)silyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate |
| SMILES | COC(=O)N1CCC[C@H]2[C@H](C[Si](C)(C)c3ccccc3)CCC[C@H]21 |
| InChI | InChI=1S/C20H31NO2Si/c1-23-20(22)21-14-8-12-18-16(9-7-13-19(18)21)15-24(2,3)17-10-5-4-6-11-17/h4-6,10-11,16,18-19H,7-9,12-15H2,1-3H3/t16-,18-,19+/m0/s1 |
| InChIKey | BVFFUEJGRKJIFC-YTQUADARSA-N |
| XLogP | 4.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|