C16H24N2O3 — CID 104503048
3-[4-[3-(ethylamino)butanoylamino]phenyl]butanoic acid (PubChem CID 104503048) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 3-[4-[3-(ethylamino)butanoylamino]phenyl]butanoic acid.
| Compound Name | 3-[4-[3-(ethylamino)butanoylamino]phenyl]butanoic acid |
|---|---|
| PubChem CID | 104503048 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 3-[4-[3-(ethylamino)butanoylamino]phenyl]butanoic acid |
| SMILES | CCNC(C)CC(=O)Nc1ccc(C(C)CC(=O)O)cc1 |
| InChI | InChI=1S/C16H24N2O3/c1-4-17-12(3)10-15(19)18-14-7-5-13(6-8-14)11(2)9-16(20)21/h5-8,11-12,17H,4,9-10H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | KTIUVMPHHSYLHS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |