C17H25LiO5S — CID 10450411
lithium (3R,4S,5S)-1-(benzenesulfonyl)-5-(methoxymethoxy)-4,6-dimethylhept-1-en-3-ol (PubChem CID 10450411) has the molecular formula C17H25LiO5S and a molecular weight of 348.39 g/mol. Its IUPAC name is lithium (3R,4S,5S)-1-(benzenesulfonyl)-5-(methoxymethoxy)-4,6-dimethylhept-1-en-3-ol.
| Compound Name | lithium (3R,4S,5S)-1-(benzenesulfonyl)-5-(methoxymethoxy)-4,6-dimethylhept-1-en-3-ol |
|---|---|
| PubChem CID | 10450411 |
| Molecular Formula | C17H25LiO5S |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | lithium (3R,4S,5S)-1-(benzenesulfonyl)-5-(methoxymethoxy)-4,6-dimethylhept-1-en-3-ol |
| SMILES | COCO[C@@H](C(C)C)[C@@H](C)[C@@H](O)/C=[C-]/S(=O)(=O)c1ccccc1.[Li+] |
| InChI | InChI=1S/C17H25O5S.Li/c1-13(2)17(22-12-21-4)14(3)16(18)10-11-23(19,20)15-8-6-5-7-9-15;/h5-10,13-14,16-18H,12H2,1-4H3;/q-1;+1/t14-,16-,17-;/m0./s1 |
| InChIKey | UYLGJMAUHOINHF-BDURURIASA-N |
| XLogP | -0.58 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|