C22H23NOS — CID 10450498
6-(4-methylphenyl)-7-(4-methylsulfanylphenyl)-2,3,8,8a-tetrahydro-1H-indolizin-5-one (PubChem CID 10450498) has the molecular formula C22H23NOS and a molecular weight of 349.50 g/mol. Its IUPAC name is 6-(4-methylphenyl)-7-(4-methylsulfanylphenyl)-2,3,8,8a-tetrahydro-1H-indolizin-5-one.
| Compound Name | 6-(4-methylphenyl)-7-(4-methylsulfanylphenyl)-2,3,8,8a-tetrahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 10450498 |
| Molecular Formula | C22H23NOS |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 6-(4-methylphenyl)-7-(4-methylsulfanylphenyl)-2,3,8,8a-tetrahydro-1H-indolizin-5-one |
| SMILES | CSc1ccc(C2=C(c3ccc(C)cc3)C(=O)N3CCCC3C2)cc1 |
| InChI | InChI=1S/C22H23NOS/c1-15-5-7-17(8-6-15)21-20(16-9-11-19(25-2)12-10-16)14-18-4-3-13-23(18)22(21)24/h5-12,18H,3-4,13-14H2,1-2H3 |
| InChIKey | GLMLLAFWCIQJNH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|