C16H18N2O2 — CID 104505267
2-[1-(isoquinolin-4-ylmethyl)pyrrolidin-2-yl]acetic acid (PubChem CID 104505267) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-[1-(isoquinolin-4-ylmethyl)pyrrolidin-2-yl]acetic acid.
| Compound Name | 2-[1-(isoquinolin-4-ylmethyl)pyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 104505267 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-[1-(isoquinolin-4-ylmethyl)pyrrolidin-2-yl]acetic acid |
| SMILES | O=C(O)CC1CCCN1Cc1cncc2ccccc12 |
| InChI | InChI=1S/C16H18N2O2/c19-16(20)8-14-5-3-7-18(14)11-13-10-17-9-12-4-1-2-6-15(12)13/h1-2,4,6,9-10,14H,3,5,7-8,11H2,(H,19,20) |
| InChIKey | RZOKBWXCKMJXAK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |