C14H21BrN4 — CID 104507019
6-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-5-bromo-4-methylpyridin-3-amine (PubChem CID 104507019) has the molecular formula C14H21BrN4 and a molecular weight of 325.25 g/mol. Its IUPAC name is 6-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-5-bromo-4-methylpyridin-3-amine.
| Compound Name | 6-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-5-bromo-4-methylpyridin-3-amine |
|---|---|
| PubChem CID | 104507019 |
| Molecular Formula | C14H21BrN4 |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 6-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-5-bromo-4-methylpyridin-3-amine |
| SMILES | Cc1c(N)cnc(N2CCN3CCCCC3C2)c1Br |
| InChI | InChI=1S/C14H21BrN4/c1-10-12(16)8-17-14(13(10)15)19-7-6-18-5-3-2-4-11(18)9-19/h8,11H,2-7,9,16H2,1H3 |
| InChIKey | GHTCWEMYIBCDBJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |