C12H24N3O7P — CID 10450707
(2S)-2-amino-5-[[(2S)-3-methyl-1-oxo-1-(1-phosphonoethylamino)butan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 10450707) has the molecular formula C12H24N3O7P and a molecular weight of 353.31 g/mol. Its IUPAC name is (2S)-2-amino-5-[[(2S)-3-methyl-1-oxo-1-(1-phosphonoethylamino)butan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-[[(2S)-3-methyl-1-oxo-1-(1-phosphonoethylamino)butan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 10450707 |
| Molecular Formula | C12H24N3O7P |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | (2S)-2-amino-5-[[(2S)-3-methyl-1-oxo-1-(1-phosphonoethylamino)butan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)NC(C)P(=O)(O)O |
| InChI | InChI=1S/C12H24N3O7P/c1-6(2)10(11(17)14-7(3)23(20,21)22)15-9(16)5-4-8(13)12(18)19/h6-8,10H,4-5,13H2,1-3H3,(H,14,17)(H,15,16)(H,18,19)(H2,20,21,22)/t7?,8-,10-/m0/s1 |
| InChIKey | BTBLNZFPVCJWSM-CFGJQEBVSA-N |
| XLogP | -1.04 |
| TPSA | 179.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|