About (3S)-3-[(4-fluoro-2,3-dihydro-1-benzothiophen-7-yl)oxy]-N-methyl-3-phenylpropan-1-amine
(3S)-3-[(4-fluoro-2,3-dihydro-1-benzothiophen-7-yl)oxy]-N-methyl-3-phenylpropan-1-amine (PubChem CID 10450757) has the molecular formula C18H20FNOS
and a molecular weight of 317.43 g/mol. Its IUPAC name is (3S)-3-[(4-fluoro-2,3-dihydro-1-benzothiophen-7-yl)oxy]-N-methyl-3-phenylpropan-1-amine.
Molecular Properties
| Compound Name | (3S)-3-[(4-fluoro-2,3-dihydro-1-benzothiophen-7-yl)oxy]-N-methyl-3-phenylpropan-1-amine |
| PubChem CID | 10450757 |
| Molecular Formula | C18H20FNOS |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | (3S)-3-[(4-fluoro-2,3-dihydro-1-benzothiophen-7-yl)oxy]-N-methyl-3-phenylpropan-1-amine |
| SMILES | CNCC[C@H](Oc1ccc(F)c2c1SCC2)c1ccccc1 |
| InChI | InChI=1S/C18H20FNOS/c1-20-11-9-16(13-5-3-2-4-6-13)21-17-8-7-15(19)14-10-12-22-18(14)17/h2-8,16,20H,9-12H2,1H3/t16-/m0/s1 |
| InChIKey | MYEULRSLYWKDLD-INIZCTEOSA-N |
| XLogP | 4.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-[(4-fluoro-2,3-dihydro-1-benzothiophen-7-yl)oxy]-N-methyl-3-phenylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[(4-fluoro-2,3-dihydro-1-benzothiophen-7-yl)oxy]-N-methyl-3-phenylpropan-1-amine?
The IUPAC name of (3S)-3-[(4-fluoro-2,3-dihydro-1-benzothiophen-7-yl)oxy]-N-methyl-3-phenylpropan-1-amine (CID 10450757) is (3S)-3-[(4-fluoro-2,3-dihydro-1-benzothiophen-7-yl)oxy]-N-methyl-3-phenylpropan-1-amine.
What is the SMILES notation for (3S)-3-[(4-fluoro-2,3-dihydro-1-benzothiophen-7-yl)oxy]-N-methyl-3-phenylpropan-1-amine?
The canonical SMILES for (3S)-3-[(4-fluoro-2,3-dihydro-1-benzothiophen-7-yl)oxy]-N-methyl-3-phenylpropan-1-amine is CNCC[C@H](Oc1ccc(F)c2c1SCC2)c1ccccc1.
What is the InChIKey of (3S)-3-[(4-fluoro-2,3-dihydro-1-benzothiophen-7-yl)oxy]-N-methyl-3-phenylpropan-1-amine?
The InChIKey is MYEULRSLYWKDLD-INIZCTEOSA-N. The full InChI is InChI=1S/C18H20FNOS/c1-20-11-9-16(13-5-3-2-4-6-13)21-17-8-7-15(19)14-10-12-22-18(14)17/h2-8,16,20H,9-12H2,1H3/t16-/m0/s1.
What are the key properties of (3S)-3-[(4-fluoro-2,3-dihydro-1-benzothiophen-7-yl)oxy]-N-methyl-3-phenylpropan-1-amine?
(3S)-3-[(4-fluoro-2,3-dihydro-1-benzothiophen-7-yl)oxy]-N-methyl-3-phenylpropan-1-amine has a molecular weight of 317.43 g/mol, XLogP of 4.20, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[(4-fluoro-2,3-dihydro-1-benzothiophen-7-yl)oxy]-N-methyl-3-phenylpropan-1-amine is sourced from PubChem (CID 10450757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).