C15H24N2OS — CID 104509851
N-[[2-cyclopropyl-3-(1,3-thiazol-4-ylmethyl)oxolan-3-yl]methyl]propan-1-amine (PubChem CID 104509851) has the molecular formula C15H24N2OS and a molecular weight of 280.44 g/mol. Its IUPAC name is N-[[2-cyclopropyl-3-(1,3-thiazol-4-ylmethyl)oxolan-3-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-cyclopropyl-3-(1,3-thiazol-4-ylmethyl)oxolan-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 104509851 |
| Molecular Formula | C15H24N2OS |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | N-[[2-cyclopropyl-3-(1,3-thiazol-4-ylmethyl)oxolan-3-yl]methyl]propan-1-amine |
| SMILES | CCCNCC1(Cc2cscn2)CCOC1C1CC1 |
| InChI | InChI=1S/C15H24N2OS/c1-2-6-16-10-15(8-13-9-19-11-17-13)5-7-18-14(15)12-3-4-12/h9,11-12,14,16H,2-8,10H2,1H3 |
| InChIKey | VUBPFNLNXKSZSL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|