About 4-[2-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]ethyl]-1-benzofuran-5-yl]benzonitrile
4-[2-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]ethyl]-1-benzofuran-5-yl]benzonitrile (PubChem CID 10451051) has the molecular formula C24H26N2O
and a molecular weight of 358.49 g/mol. Its IUPAC name is 4-[2-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]ethyl]-1-benzofuran-5-yl]benzonitrile.
Molecular Properties
| Compound Name | 4-[2-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]ethyl]-1-benzofuran-5-yl]benzonitrile |
| PubChem CID | 10451051 |
| Molecular Formula | C24H26N2O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 4-[2-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]ethyl]-1-benzofuran-5-yl]benzonitrile |
| SMILES | C[C@@H]1CCC[C@H](C)N1CCc1cc2cc(-c3ccc(C#N)cc3)ccc2o1 |
| InChI | InChI=1S/C24H26N2O/c1-17-4-3-5-18(2)26(17)13-12-23-15-22-14-21(10-11-24(22)27-23)20-8-6-19(16-25)7-9-20/h6-11,14-15,17-18H,3-5,12-13H2,1-2H3/t17-,18+ |
| InChIKey | DCIRDTIBHJXEGG-HDICACEKSA-N |
| XLogP | 5.78 |
| TPSA | 40.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]ethyl]-1-benzofuran-5-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]ethyl]-1-benzofuran-5-yl]benzonitrile?
The IUPAC name of 4-[2-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]ethyl]-1-benzofuran-5-yl]benzonitrile (CID 10451051) is 4-[2-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]ethyl]-1-benzofuran-5-yl]benzonitrile.
What is the SMILES notation for 4-[2-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]ethyl]-1-benzofuran-5-yl]benzonitrile?
The canonical SMILES for 4-[2-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]ethyl]-1-benzofuran-5-yl]benzonitrile is C[C@@H]1CCC[C@H](C)N1CCc1cc2cc(-c3ccc(C#N)cc3)ccc2o1.
What is the InChIKey of 4-[2-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]ethyl]-1-benzofuran-5-yl]benzonitrile?
The InChIKey is DCIRDTIBHJXEGG-HDICACEKSA-N. The full InChI is InChI=1S/C24H26N2O/c1-17-4-3-5-18(2)26(17)13-12-23-15-22-14-21(10-11-24(22)27-23)20-8-6-19(16-25)7-9-20/h6-11,14-15,17-18H,3-5,12-13H2,1-2H3/t17-,18+.
What are the key properties of 4-[2-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]ethyl]-1-benzofuran-5-yl]benzonitrile?
4-[2-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]ethyl]-1-benzofuran-5-yl]benzonitrile has a molecular weight of 358.49 g/mol, XLogP of 5.78, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]ethyl]-1-benzofuran-5-yl]benzonitrile is sourced from PubChem (CID 10451051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).