C17H23ClO — CID 104510563
3-(chloromethyl)-2-cyclopropyl-3-[(3,4-dimethylphenyl)methyl]oxolane (PubChem CID 104510563) has the molecular formula C17H23ClO and a molecular weight of 278.82 g/mol. Its IUPAC name is 3-(chloromethyl)-2-cyclopropyl-3-[(3,4-dimethylphenyl)methyl]oxolane.
| Compound Name | 3-(chloromethyl)-2-cyclopropyl-3-[(3,4-dimethylphenyl)methyl]oxolane |
|---|---|
| PubChem CID | 104510563 |
| Molecular Formula | C17H23ClO |
| Molecular Weight | 278.82 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 3-(chloromethyl)-2-cyclopropyl-3-[(3,4-dimethylphenyl)methyl]oxolane |
| SMILES | Cc1ccc(CC2(CCl)CCOC2C2CC2)cc1C |
| InChI | InChI=1S/C17H23ClO/c1-12-3-4-14(9-13(12)2)10-17(11-18)7-8-19-16(17)15-5-6-15/h3-4,9,15-16H,5-8,10-11H2,1-2H3 |
| InChIKey | DOFABRLNZQIDPA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.82 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|