C20H25NO3S — CID 10451100
(2R,3S,4aR,10aR)-4a-ethyl-3-methyl-2-(1,3-thiazol-2-yl)-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3,7-triol (PubChem CID 10451100) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is (2R,3S,4aR,10aR)-4a-ethyl-3-methyl-2-(1,3-thiazol-2-yl)-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3,7-triol.
| Compound Name | (2R,3S,4aR,10aR)-4a-ethyl-3-methyl-2-(1,3-thiazol-2-yl)-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3,7-triol |
|---|---|
| PubChem CID | 10451100 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | (2R,3S,4aR,10aR)-4a-ethyl-3-methyl-2-(1,3-thiazol-2-yl)-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3,7-triol |
| SMILES | CC[C@@]12C[C@](C)(O)[C@@](O)(c3nccs3)C[C@H]1CCc1cc(O)ccc12 |
| InChI | InChI=1S/C20H25NO3S/c1-3-19-12-18(2,23)20(24,17-21-8-9-25-17)11-14(19)5-4-13-10-15(22)6-7-16(13)19/h6-10,14,22-24H,3-5,11-12H2,1-2H3/t14-,18+,19-,20+/m1/s1 |
| InChIKey | JJKRJVYCNAXILF-YGBSJELFSA-N |
| XLogP | 3.49 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |